ChemNet > CAS > 423768-58-5 1-cyclopropyl-2,5-dimethyl-1H-pyrrole-3-carboxylic acid
423768-58-5 1-cyclopropyl-2,5-dimethyl-1H-pyrrole-3-carboxylic acid
produktnavn |
1-cyclopropyl-2,5-dimethyl-1H-pyrrole-3-carboxylic acid |
Molekylær Formel |
C10H13NO2 |
Molekylvekt |
179.2157 |
InChI |
InChI=1/C10H13NO2/c1-6-5-9(10(12)13)7(2)11(6)8-3-4-8/h5,8H,3-4H2,1-2H3,(H,12,13) |
CAS-nummer |
423768-58-5 |
Molecular Structure |
|
Tetthet |
1.27g/cm3 |
Smeltepunkt |
177℃ |
Kokepunkt |
353.1°C at 760 mmHg |
Brytningsindeks |
1.613 |
Flammepunktet |
167.4°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|